C30H28Cl2NO5S- — CID 71192481
2,3-dichloro-4-[6-methoxy-1-[4-(2-piperidin-1-ylethoxy)phenoxy]naphthalen-2-yl]benzenesulfinate (PubChem CID 71192481) has the molecular formula C30H28Cl2NO5S- and a molecular weight of 585.53 g/mol. Its IUPAC name is 2,3-dichloro-4-[6-methoxy-1-[4-(2-piperidin-1-ylethoxy)phenoxy]naphthalen-2-yl]benzenesulfinate.
| Compound Name | 2,3-dichloro-4-[6-methoxy-1-[4-(2-piperidin-1-ylethoxy)phenoxy]naphthalen-2-yl]benzenesulfinate |
|---|---|
| PubChem CID | 71192481 |
| Molecular Formula | C30H28Cl2NO5S- |
| Molecular Weight | 585.53 g/mol |
| Exact Mass | 584.11 |
| IUPAC Name | 2,3-dichloro-4-[6-methoxy-1-[4-(2-piperidin-1-ylethoxy)phenoxy]naphthalen-2-yl]benzenesulfinate |
| SMILES | COc1ccc2c(Oc3ccc(OCCN4CCCCC4)cc3)c(-c3ccc(S(=O)[O-])c(Cl)c3Cl)ccc2c1 |
| InChI | InChI=1S/C30H29Cl2NO5S/c1-36-23-10-12-24-20(19-23)5-11-26(25-13-14-27(39(34)35)29(32)28(25)31)30(24)38-22-8-6-21(7-9-22)37-18-17-33-15-3-2-4-16-33/h5-14,19H,2-4,15-18H2,1H3,(H,34,35)/p-1 |
| InChIKey | ZFISVZRIGHSOKG-UHFFFAOYSA-M |
| XLogP | 7.72 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.53 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|