C16H18S — CID 71192530
2,5-di(cyclohexa-1,5-dien-1-yl)-2,3-dihydrothiophene (PubChem CID 71192530) has the molecular formula C16H18S and a molecular weight of 242.39 g/mol. Its IUPAC name is 2,5-di(cyclohexa-1,5-dien-1-yl)-2,3-dihydrothiophene.
| Compound Name | 2,5-di(cyclohexa-1,5-dien-1-yl)-2,3-dihydrothiophene |
|---|---|
| PubChem CID | 71192530 |
| Molecular Formula | C16H18S |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 2,5-di(cyclohexa-1,5-dien-1-yl)-2,3-dihydrothiophene |
| SMILES | C1=CC(C2=CCC(C3=CCCC=C3)S2)=CCC1 |
| InChI | InChI=1S/C16H18S/c1-3-7-13(8-4-1)15-11-12-16(17-15)14-9-5-2-6-10-14/h3,5,7-11,16H,1-2,4,6,12H2 |
| InChIKey | KBFHYHHLCFWMHH-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |