C15H20N2 — CID 71192553
(8S)-8-ethyl-5,11-dimethyl-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,10-tetraene (PubChem CID 71192553) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is (8S)-8-ethyl-5,11-dimethyl-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,10-tetraene.
| Compound Name | (8S)-8-ethyl-5,11-dimethyl-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,10-tetraene |
|---|---|
| PubChem CID | 71192553 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | (8S)-8-ethyl-5,11-dimethyl-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,10-tetraene |
| SMILES | CC[C@@H]1C2=C(NCC(C)=C2)C2=NC=C(C)CC21 |
| InChI | InChI=1S/C15H20N2/c1-4-11-12-5-9(2)7-16-14(12)15-13(11)6-10(3)8-17-15/h5,8,11,13,16H,4,6-7H2,1-3H3/t11-,13?/m1/s1 |
| InChIKey | ZBMNLYCUOKMOMK-JTDNENJMSA-N |
| XLogP | 3.19 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |