C13H16N2 — CID 71192554
5,11-dimethyl-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,10-tetraene (PubChem CID 71192554) has the molecular formula C13H16N2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 5,11-dimethyl-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,10-tetraene.
| Compound Name | 5,11-dimethyl-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,10-tetraene |
|---|---|
| PubChem CID | 71192554 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 5,11-dimethyl-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,10-tetraene |
| SMILES | CC1=CC2=C(NC1)C1=NC=C(C)CC1C2 |
| InChI | InChI=1S/C13H16N2/c1-8-3-10-5-11-4-9(2)7-15-13(11)12(10)14-6-8/h3,7,11,14H,4-6H2,1-2H3 |
| InChIKey | DUWJZYWBNYMPEY-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |