C20H28N2 — CID 71192692
(Z)-3-[(7aS)-5-cyclohexa-2,4-dien-1-yl-3,5-dimethyl-1,4,4a,7a-tetrahydrocyclopenta[b]pyridin-6-yl]-2-methylprop-2-en-1-amine (PubChem CID 71192692) has the molecular formula C20H28N2 and a molecular weight of 296.46 g/mol. Its IUPAC name is (Z)-3-[(7aS)-5-cyclohexa-2,4-dien-1-yl-3,5-dimethyl-1,4,4a,7a-tetrahydrocyclopenta[b]pyridin-6-yl]-2-methylprop-2-en-1-amine.
| Compound Name | (Z)-3-[(7aS)-5-cyclohexa-2,4-dien-1-yl-3,5-dimethyl-1,4,4a,7a-tetrahydrocyclopenta[b]pyridin-6-yl]-2-methylprop-2-en-1-amine |
|---|---|
| PubChem CID | 71192692 |
| Molecular Formula | C20H28N2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | (Z)-3-[(7aS)-5-cyclohexa-2,4-dien-1-yl-3,5-dimethyl-1,4,4a,7a-tetrahydrocyclopenta[b]pyridin-6-yl]-2-methylprop-2-en-1-amine |
| SMILES | CC1=CN[C@H]2C=C(/C=C(/C)CN)C(C)(C3C=CC=CC3)C2C1 |
| InChI | InChI=1S/C20H28N2/c1-14(12-21)9-17-11-19-18(10-15(2)13-22-19)20(17,3)16-7-5-4-6-8-16/h4-7,9,11,13,16,18-19,22H,8,10,12,21H2,1-3H3/b14-9-/t16?,18?,19-,20?/m0/s1 |
| InChIKey | NHTKUKBGYSFRAG-SJXVQIBCSA-N |
| XLogP | 3.85 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |