C24H32F3N3O2S — CID 71193393
(2R,3R,4S)-3-[(3R)-4-(dimethylsulfamoylamino)-3-methylbutyl]-4-methyl-2-phenyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline (PubChem CID 71193393) has the molecular formula C24H32F3N3O2S and a molecular weight of 483.60 g/mol. Its IUPAC name is (2R,3R,4S)-3-[(3R)-4-(dimethylsulfamoylamino)-3-methylbutyl]-4-methyl-2-phenyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | (2R,3R,4S)-3-[(3R)-4-(dimethylsulfamoylamino)-3-methylbutyl]-4-methyl-2-phenyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 71193393 |
| Molecular Formula | C24H32F3N3O2S |
| Molecular Weight | 483.60 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | (2R,3R,4S)-3-[(3R)-4-(dimethylsulfamoylamino)-3-methylbutyl]-4-methyl-2-phenyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline |
| SMILES | C[C@H](CC[C@@H]1[C@H](C)c2cc(C(F)(F)F)ccc2N[C@H]1c1ccccc1)CNS(=O)(=O)N(C)C |
| InChI | InChI=1S/C24H32F3N3O2S/c1-16(15-28-33(31,32)30(3)4)10-12-20-17(2)21-14-19(24(25,26)27)11-13-22(21)29-23(20)18-8-6-5-7-9-18/h5-9,11,13-14,16-17,20,23,28-29H,10,12,15H2,1-4H3/t16-,17+,20-,23+/m1/s1 |
| InChIKey | GCJQWWANLQQYGU-UGBDLMATSA-N |
| XLogP | 5.40 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.60 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |