About ethyl spiro[2H-1-benzofuran-3,4'-piperidine]-2-carboxylate
ethyl spiro[2H-1-benzofuran-3,4'-piperidine]-2-carboxylate (PubChem CID 71193421) has the molecular formula C15H19NO3
and a molecular weight of 261.32 g/mol. Its IUPAC name is ethyl spiro[2H-1-benzofuran-3,4'-piperidine]-2-carboxylate.
Molecular Properties
| Compound Name | ethyl spiro[2H-1-benzofuran-3,4'-piperidine]-2-carboxylate |
| PubChem CID | 71193421 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | ethyl spiro[2H-1-benzofuran-3,4'-piperidine]-2-carboxylate |
| SMILES | CCOC(=O)C1Oc2ccccc2C12CCNCC2 |
| InChI | InChI=1S/C15H19NO3/c1-2-18-14(17)13-15(7-9-16-10-8-15)11-5-3-4-6-12(11)19-13/h3-6,13,16H,2,7-10H2,1H3 |
| InChIKey | AIYXTVTVVHLCCR-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl spiro[2H-1-benzofuran-3,4'-piperidine]-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl spiro[2H-1-benzofuran-3,4'-piperidine]-2-carboxylate?
The IUPAC name of ethyl spiro[2H-1-benzofuran-3,4'-piperidine]-2-carboxylate (CID 71193421) is ethyl spiro[2H-1-benzofuran-3,4'-piperidine]-2-carboxylate.
What is the SMILES notation for ethyl spiro[2H-1-benzofuran-3,4'-piperidine]-2-carboxylate?
The canonical SMILES for ethyl spiro[2H-1-benzofuran-3,4'-piperidine]-2-carboxylate is CCOC(=O)C1Oc2ccccc2C12CCNCC2.
What is the InChIKey of ethyl spiro[2H-1-benzofuran-3,4'-piperidine]-2-carboxylate?
The InChIKey is AIYXTVTVVHLCCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO3/c1-2-18-14(17)13-15(7-9-16-10-8-15)11-5-3-4-6-12(11)19-13/h3-6,13,16H,2,7-10H2,1H3.
What are the key properties of ethyl spiro[2H-1-benzofuran-3,4'-piperidine]-2-carboxylate?
ethyl spiro[2H-1-benzofuran-3,4'-piperidine]-2-carboxylate has a molecular weight of 261.32 g/mol, XLogP of 1.63, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl spiro[2H-1-benzofuran-3,4'-piperidine]-2-carboxylate is sourced from PubChem (CID 71193421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).