C19H21F3N2O — CID 71193636
[4-phenyl-8-(trifluoromethyl)-2,3,3a,4,5,7,8,9b-octahydrofuro[3,2-c]quinolin-2-yl]methanamine (PubChem CID 71193636) has the molecular formula C19H21F3N2O and a molecular weight of 350.38 g/mol. Its IUPAC name is [4-phenyl-8-(trifluoromethyl)-2,3,3a,4,5,7,8,9b-octahydrofuro[3,2-c]quinolin-2-yl]methanamine.
| Compound Name | [4-phenyl-8-(trifluoromethyl)-2,3,3a,4,5,7,8,9b-octahydrofuro[3,2-c]quinolin-2-yl]methanamine |
|---|---|
| PubChem CID | 71193636 |
| Molecular Formula | C19H21F3N2O |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | [4-phenyl-8-(trifluoromethyl)-2,3,3a,4,5,7,8,9b-octahydrofuro[3,2-c]quinolin-2-yl]methanamine |
| SMILES | NCC1CC2C(O1)C1=CC(C(F)(F)F)CC=C1NC2c1ccccc1 |
| InChI | InChI=1S/C19H21F3N2O/c20-19(21,22)12-6-7-16-14(8-12)18-15(9-13(10-23)25-18)17(24-16)11-4-2-1-3-5-11/h1-5,7-8,12-13,15,17-18,24H,6,9-10,23H2 |
| InChIKey | HIFPRDLULYEWRF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |