C21H27ClFNO — CID 71193645
(2R)-4-[(2S,3R,4S)-8-chloro-2-cyclohexa-2,4-dien-1-yl-6-fluoro-4-methyl-1,2,3,4-tetrahydroquinolin-3-yl]-2-methylbutan-1-ol (PubChem CID 71193645) has the molecular formula C21H27ClFNO and a molecular weight of 363.90 g/mol. Its IUPAC name is (2R)-4-[(2S,3R,4S)-8-chloro-2-cyclohexa-2,4-dien-1-yl-6-fluoro-4-methyl-1,2,3,4-tetrahydroquinolin-3-yl]-2-methylbutan-1-ol.
| Compound Name | (2R)-4-[(2S,3R,4S)-8-chloro-2-cyclohexa-2,4-dien-1-yl-6-fluoro-4-methyl-1,2,3,4-tetrahydroquinolin-3-yl]-2-methylbutan-1-ol |
|---|---|
| PubChem CID | 71193645 |
| Molecular Formula | C21H27ClFNO |
| Molecular Weight | 363.90 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | (2R)-4-[(2S,3R,4S)-8-chloro-2-cyclohexa-2,4-dien-1-yl-6-fluoro-4-methyl-1,2,3,4-tetrahydroquinolin-3-yl]-2-methylbutan-1-ol |
| SMILES | C[C@@H](CO)CC[C@@H]1[C@H](C)c2cc(F)cc(Cl)c2N[C@H]1C1C=CC=CC1 |
| InChI | InChI=1S/C21H27ClFNO/c1-13(12-25)8-9-17-14(2)18-10-16(23)11-19(22)21(18)24-20(17)15-6-4-3-5-7-15/h3-6,10-11,13-15,17,20,24-25H,7-9,12H2,1-2H3/t13-,14+,15?,17-,20+/m1/s1 |
| InChIKey | LASNOFFXUABOHR-JNVLKYLSSA-N |
| XLogP | 5.53 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.90 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |