C24H31N3O3 — CID 71194073
2-[[3-[(1S,2R)-2-amino-1,2-dihydroxyethyl]-1-benzyl-2-methylindol-4-yl]methyl]-3-methylbutanamide (PubChem CID 71194073) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is 2-[[3-[(1S,2R)-2-amino-1,2-dihydroxyethyl]-1-benzyl-2-methylindol-4-yl]methyl]-3-methylbutanamide.
| Compound Name | 2-[[3-[(1S,2R)-2-amino-1,2-dihydroxyethyl]-1-benzyl-2-methylindol-4-yl]methyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 71194073 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | 2-[[3-[(1S,2R)-2-amino-1,2-dihydroxyethyl]-1-benzyl-2-methylindol-4-yl]methyl]-3-methylbutanamide |
| SMILES | Cc1c([C@H](O)[C@H](N)O)c2c(CC(C(N)=O)C(C)C)cccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C24H31N3O3/c1-14(2)18(23(25)29)12-17-10-7-11-19-21(17)20(22(28)24(26)30)15(3)27(19)13-16-8-5-4-6-9-16/h4-11,14,18,22,24,28,30H,12-13,26H2,1-3H3,(H2,25,29)/t18?,22-,24+/m0/s1 |
| InChIKey | ADHYDIIPESHOCZ-MKXFTGRQSA-N |
| XLogP | 2.61 |
| TPSA | 114.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|