About 7-ethyl-2,4-dimethylbenzo[b][1,8]naphthyridin-5-amine
7-ethyl-2,4-dimethylbenzo[b][1,8]naphthyridin-5-amine (PubChem CID 711946) has the molecular formula C16H17N3
and a molecular weight of 251.33 g/mol. Its IUPAC name is 7-ethyl-2,4-dimethylbenzo[b][1,8]naphthyridin-5-amine.
Molecular Properties
| Compound Name | 7-ethyl-2,4-dimethylbenzo[b][1,8]naphthyridin-5-amine |
| PubChem CID | 711946 |
| Molecular Formula | C16H17N3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 7-ethyl-2,4-dimethylbenzo[b][1,8]naphthyridin-5-amine |
| SMILES | CCc1ccc2nc3nc(C)cc(C)c3c(N)c2c1 |
| InChI | InChI=1S/C16H17N3/c1-4-11-5-6-13-12(8-11)15(17)14-9(2)7-10(3)18-16(14)19-13/h5-8H,4H2,1-3H3,(H2,17,18,19) |
| InChIKey | KQHCYSPQLCJYQP-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 7-ethyl-2,4-dimethylbenzo[b][1,8]naphthyridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyl-2,4-dimethylbenzo[b][1,8]naphthyridin-5-amine?
The IUPAC name of 7-ethyl-2,4-dimethylbenzo[b][1,8]naphthyridin-5-amine (CID 711946) is 7-ethyl-2,4-dimethylbenzo[b][1,8]naphthyridin-5-amine.
What is the SMILES notation for 7-ethyl-2,4-dimethylbenzo[b][1,8]naphthyridin-5-amine?
The canonical SMILES for 7-ethyl-2,4-dimethylbenzo[b][1,8]naphthyridin-5-amine is CCc1ccc2nc3nc(C)cc(C)c3c(N)c2c1.
What is the InChIKey of 7-ethyl-2,4-dimethylbenzo[b][1,8]naphthyridin-5-amine?
The InChIKey is KQHCYSPQLCJYQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3/c1-4-11-5-6-13-12(8-11)15(17)14-9(2)7-10(3)18-16(14)19-13/h5-8H,4H2,1-3H3,(H2,17,18,19).
What are the key properties of 7-ethyl-2,4-dimethylbenzo[b][1,8]naphthyridin-5-amine?
7-ethyl-2,4-dimethylbenzo[b][1,8]naphthyridin-5-amine has a molecular weight of 251.33 g/mol, XLogP of 3.54, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyl-2,4-dimethylbenzo[b][1,8]naphthyridin-5-amine is sourced from PubChem (CID 711946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).