C18H30O — CID 71194876
(1S,3aS,4aR,8bS)-1-butoxy-4a,7-dimethyl-2,3,3a,4,5,8,8a,8b-octahydro-1H-cyclopenta[a]indene (PubChem CID 71194876) has the molecular formula C18H30O and a molecular weight of 262.44 g/mol. Its IUPAC name is (1S,3aS,4aR,8bS)-1-butoxy-4a,7-dimethyl-2,3,3a,4,5,8,8a,8b-octahydro-1H-cyclopenta[a]indene.
| Compound Name | (1S,3aS,4aR,8bS)-1-butoxy-4a,7-dimethyl-2,3,3a,4,5,8,8a,8b-octahydro-1H-cyclopenta[a]indene |
|---|---|
| PubChem CID | 71194876 |
| Molecular Formula | C18H30O |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.23 |
| IUPAC Name | (1S,3aS,4aR,8bS)-1-butoxy-4a,7-dimethyl-2,3,3a,4,5,8,8a,8b-octahydro-1H-cyclopenta[a]indene |
| SMILES | CCCCO[C@H]1CC[C@H]2C[C@]3(C)CC=C(C)CC3[C@H]21 |
| InChI | InChI=1S/C18H30O/c1-4-5-10-19-16-7-6-14-12-18(3)9-8-13(2)11-15(18)17(14)16/h8,14-17H,4-7,9-12H2,1-3H3/t14-,15?,16-,17-,18-/m0/s1 |
| InChIKey | BSPRKWVPRKXFJQ-JBGVAKJSSA-N |
| XLogP | 4.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|