C18H30O3 — CID 71194877
(1S,3aR,4S,4aR,8bR)-1-butoxy-4a-(hydroxymethyl)-7-methyl-2,3,3a,4,5,8,8a,8b-octahydro-1H-cyclopenta[a]inden-4-ol (PubChem CID 71194877) has the molecular formula C18H30O3 and a molecular weight of 294.44 g/mol. Its IUPAC name is (1S,3aR,4S,4aR,8bR)-1-butoxy-4a-(hydroxymethyl)-7-methyl-2,3,3a,4,5,8,8a,8b-octahydro-1H-cyclopenta[a]inden-4-ol.
| Compound Name | (1S,3aR,4S,4aR,8bR)-1-butoxy-4a-(hydroxymethyl)-7-methyl-2,3,3a,4,5,8,8a,8b-octahydro-1H-cyclopenta[a]inden-4-ol |
|---|---|
| PubChem CID | 71194877 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | (1S,3aR,4S,4aR,8bR)-1-butoxy-4a-(hydroxymethyl)-7-methyl-2,3,3a,4,5,8,8a,8b-octahydro-1H-cyclopenta[a]inden-4-ol |
| SMILES | CCCCO[C@H]1CC[C@@H]2[C@H]1C1CC(C)=CC[C@@]1(CO)[C@H]2O |
| InChI | InChI=1S/C18H30O3/c1-3-4-9-21-15-6-5-13-16(15)14-10-12(2)7-8-18(14,11-19)17(13)20/h7,13-17,19-20H,3-6,8-11H2,1-2H3/t13-,14?,15+,16+,17+,18+/m1/s1 |
| InChIKey | WLRPXZOWVHCVMJ-UAINQKQTSA-N |
| XLogP | 2.91 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|