C34H59NO8 — CID 71194896
[(3Z,6S,7S,8R,9S,11Z,13S,14S,16Z)-8,14,18-trihydroxy-19-[(3S,4S)-4-methoxy-3,5-dimethyl-6-oxooxan-2-yl]-5,7,9,11,13,15-hexamethylnonadeca-3,11,16-trien-6-yl] carbamate (PubChem CID 71194896) has the molecular formula C34H59NO8 and a molecular weight of 609.85 g/mol. Its IUPAC name is [(3Z,6S,7S,8R,9S,11Z,13S,14S,16Z)-8,14,18-trihydroxy-19-[(3S,4S)-4-methoxy-3,5-dimethyl-6-oxooxan-2-yl]-5,7,9,11,13,15-hexamethylnonadeca-3,11,16-trien-6-yl] carbamate.
| Compound Name | [(3Z,6S,7S,8R,9S,11Z,13S,14S,16Z)-8,14,18-trihydroxy-19-[(3S,4S)-4-methoxy-3,5-dimethyl-6-oxooxan-2-yl]-5,7,9,11,13,15-hexamethylnonadeca-3,11,16-trien-6-yl] carbamate |
|---|---|
| PubChem CID | 71194896 |
| Molecular Formula | C34H59NO8 |
| Molecular Weight | 609.85 g/mol |
| Exact Mass | 609.42 |
| IUPAC Name | [(3Z,6S,7S,8R,9S,11Z,13S,14S,16Z)-8,14,18-trihydroxy-19-[(3S,4S)-4-methoxy-3,5-dimethyl-6-oxooxan-2-yl]-5,7,9,11,13,15-hexamethylnonadeca-3,11,16-trien-6-yl] carbamate |
| SMILES | CC/C=C\C(C)[C@H](OC(N)=O)[C@@H](C)[C@H](O)[C@@H](C)C/C(C)=C\[C@H](C)[C@@H](O)C(C)/C=C\C(O)CC1OC(=O)C(C)[C@@H](OC)[C@H]1C |
| InChI | InChI=1S/C34H59NO8/c1-11-12-13-21(4)31(43-34(35)40)25(8)30(38)23(6)17-19(2)16-22(5)29(37)20(3)14-15-27(36)18-28-24(7)32(41-10)26(9)33(39)42-28/h12-16,20-32,36-38H,11,17-18H2,1-10H3,(H2,35,40)/b13-12-,15-14-,19-16-/t20?,21?,22-,23-,24-,25-,26?,27?,28?,29-,30+,31-,32-/m0/s1 |
| InChIKey | ILSRKIRMLBXJLS-ILXUBKPESA-N |
| XLogP | 5.18 |
| TPSA | 148.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.85 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|