C18H22N4O — CID 71194912
(7R,9aS)-7-phenoxy-2-pyrimidin-2-yl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine (PubChem CID 71194912) has the molecular formula C18H22N4O and a molecular weight of 310.40 g/mol. Its IUPAC name is (7R,9aS)-7-phenoxy-2-pyrimidin-2-yl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine.
| Compound Name | (7R,9aS)-7-phenoxy-2-pyrimidin-2-yl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
|---|---|
| PubChem CID | 71194912 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | (7R,9aS)-7-phenoxy-2-pyrimidin-2-yl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
| SMILES | c1ccc(O[C@@H]2CC[C@H]3CN(c4ncccn4)CCN3C2)cc1 |
| InChI | InChI=1S/C18H22N4O/c1-2-5-16(6-3-1)23-17-8-7-15-13-22(12-11-21(15)14-17)18-19-9-4-10-20-18/h1-6,9-10,15,17H,7-8,11-14H2/t15-,17+/m0/s1 |
| InChIKey | HLJFCZMEGHTDNE-DOTOQJQBSA-N |
| XLogP | 2.21 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |