About 3-(1,1,1-trifluoropropan-2-yl)heptylcyclopropane
3-(1,1,1-trifluoropropan-2-yl)heptylcyclopropane (PubChem CID 71195377) has the molecular formula C13H23F3
and a molecular weight of 236.32 g/mol. Its IUPAC name is 3-(1,1,1-trifluoropropan-2-yl)heptylcyclopropane.
Molecular Properties
| Compound Name | 3-(1,1,1-trifluoropropan-2-yl)heptylcyclopropane |
| PubChem CID | 71195377 |
| Molecular Formula | C13H23F3 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 3-(1,1,1-trifluoropropan-2-yl)heptylcyclopropane |
| SMILES | CCCCC(CCC1CC1)C(C)C(F)(F)F |
| InChI | InChI=1S/C13H23F3/c1-3-4-5-12(9-8-11-6-7-11)10(2)13(14,15)16/h10-12H,3-9H2,1-2H3 |
| InChIKey | XQRVKEMUZKVVSO-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-(1,1,1-trifluoropropan-2-yl)heptylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,1,1-trifluoropropan-2-yl)heptylcyclopropane?
The IUPAC name of 3-(1,1,1-trifluoropropan-2-yl)heptylcyclopropane (CID 71195377) is 3-(1,1,1-trifluoropropan-2-yl)heptylcyclopropane.
What is the SMILES notation for 3-(1,1,1-trifluoropropan-2-yl)heptylcyclopropane?
The canonical SMILES for 3-(1,1,1-trifluoropropan-2-yl)heptylcyclopropane is CCCCC(CCC1CC1)C(C)C(F)(F)F.
What is the InChIKey of 3-(1,1,1-trifluoropropan-2-yl)heptylcyclopropane?
The InChIKey is XQRVKEMUZKVVSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23F3/c1-3-4-5-12(9-8-11-6-7-11)10(2)13(14,15)16/h10-12H,3-9H2,1-2H3.
What are the key properties of 3-(1,1,1-trifluoropropan-2-yl)heptylcyclopropane?
3-(1,1,1-trifluoropropan-2-yl)heptylcyclopropane has a molecular weight of 236.32 g/mol, XLogP of 5.18, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,1,1-trifluoropropan-2-yl)heptylcyclopropane is sourced from PubChem (CID 71195377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).