C15H27NO — CID 71195822
1-(1-ethyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-2-yl)-2,2-dimethylbutan-1-one (PubChem CID 71195822) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is 1-(1-ethyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-2-yl)-2,2-dimethylbutan-1-one.
| Compound Name | 1-(1-ethyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-2-yl)-2,2-dimethylbutan-1-one |
|---|---|
| PubChem CID | 71195822 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | 1-(1-ethyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-2-yl)-2,2-dimethylbutan-1-one |
| SMILES | CCN1C(C(=O)C(C)(C)CC)CC2CCCC21 |
| InChI | InChI=1S/C15H27NO/c1-5-15(3,4)14(17)13-10-11-8-7-9-12(11)16(13)6-2/h11-13H,5-10H2,1-4H3 |
| InChIKey | RMRARHGTCOCZML-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |