C19H26N4O — CID 7119587
1-[(2S,3S)-3-[4-(dimethylamino)phenyl]-1,4,5-triazatricyclo[5.2.2.02,6]undec-5-en-4-yl]propan-1-one (PubChem CID 7119587) has the molecular formula C19H26N4O and a molecular weight of 326.44 g/mol. Its IUPAC name is 1-[(2S,3S)-3-[4-(dimethylamino)phenyl]-1,4,5-triazatricyclo[5.2.2.02,6]undec-5-en-4-yl]propan-1-one.
| Compound Name | 1-[(2S,3S)-3-[4-(dimethylamino)phenyl]-1,4,5-triazatricyclo[5.2.2.02,6]undec-5-en-4-yl]propan-1-one |
|---|---|
| PubChem CID | 7119587 |
| Molecular Formula | C19H26N4O |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | 1-[(2S,3S)-3-[4-(dimethylamino)phenyl]-1,4,5-triazatricyclo[5.2.2.02,6]undec-5-en-4-yl]propan-1-one |
| SMILES | CCC(=O)N1N=C2C3CCN(CC3)[C@H]2[C@@H]1c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C19H26N4O/c1-4-16(24)23-18(14-5-7-15(8-6-14)21(2)3)19-17(20-23)13-9-11-22(19)12-10-13/h5-8,13,18-19H,4,9-12H2,1-3H3/t18-,19+/m0/s1 |
| InChIKey | WJARXORPHUSHDW-RBUKOAKNSA-N |
| XLogP | 2.50 |
| TPSA | 39.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|