About 2-bicyclo[2.2.1]heptanyl 2-tert-butyl-4-methyl-2-(trifluoromethyl)pent-3-enoate
2-bicyclo[2.2.1]heptanyl 2-tert-butyl-4-methyl-2-(trifluoromethyl)pent-3-enoate (PubChem CID 71196202) has the molecular formula C18H27F3O2
and a molecular weight of 332.41 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]heptanyl 2-tert-butyl-4-methyl-2-(trifluoromethyl)pent-3-enoate.
Molecular Properties
| Compound Name | 2-bicyclo[2.2.1]heptanyl 2-tert-butyl-4-methyl-2-(trifluoromethyl)pent-3-enoate |
| PubChem CID | 71196202 |
| Molecular Formula | C18H27F3O2 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 2-bicyclo[2.2.1]heptanyl 2-tert-butyl-4-methyl-2-(trifluoromethyl)pent-3-enoate |
| SMILES | CC(C)=CC(C(=O)OC1CC2CCC1C2)(C(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C18H27F3O2/c1-11(2)10-17(16(3,4)5,18(19,20)21)15(22)23-14-9-12-6-7-13(14)8-12/h10,12-14H,6-9H2,1-5H3 |
| InChIKey | OCYJDXUSPYVTJA-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-bicyclo[2.2.1]heptanyl 2-tert-butyl-4-methyl-2-(trifluoromethyl)pent-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bicyclo[2.2.1]heptanyl 2-tert-butyl-4-methyl-2-(trifluoromethyl)pent-3-enoate?
The IUPAC name of 2-bicyclo[2.2.1]heptanyl 2-tert-butyl-4-methyl-2-(trifluoromethyl)pent-3-enoate (CID 71196202) is 2-bicyclo[2.2.1]heptanyl 2-tert-butyl-4-methyl-2-(trifluoromethyl)pent-3-enoate.
What is the SMILES notation for 2-bicyclo[2.2.1]heptanyl 2-tert-butyl-4-methyl-2-(trifluoromethyl)pent-3-enoate?
The canonical SMILES for 2-bicyclo[2.2.1]heptanyl 2-tert-butyl-4-methyl-2-(trifluoromethyl)pent-3-enoate is CC(C)=CC(C(=O)OC1CC2CCC1C2)(C(C)(C)C)C(F)(F)F.
What is the InChIKey of 2-bicyclo[2.2.1]heptanyl 2-tert-butyl-4-methyl-2-(trifluoromethyl)pent-3-enoate?
The InChIKey is OCYJDXUSPYVTJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27F3O2/c1-11(2)10-17(16(3,4)5,18(19,20)21)15(22)23-14-9-12-6-7-13(14)8-12/h10,12-14H,6-9H2,1-5H3.
What are the key properties of 2-bicyclo[2.2.1]heptanyl 2-tert-butyl-4-methyl-2-(trifluoromethyl)pent-3-enoate?
2-bicyclo[2.2.1]heptanyl 2-tert-butyl-4-methyl-2-(trifluoromethyl)pent-3-enoate has a molecular weight of 332.41 g/mol, XLogP of 5.28, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bicyclo[2.2.1]heptanyl 2-tert-butyl-4-methyl-2-(trifluoromethyl)pent-3-enoate is sourced from PubChem (CID 71196202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).