C26H29N9O4S2 — CID 71196419
benzyl N-[2-[8-[amino-[5-(dimethylsulfamoyl)thiophen-2-yl]amino]-3-(1-methylpyrazol-4-yl)imidazo[1,2-a]pyrazin-6-yl]ethyl]carbamate (PubChem CID 71196419) has the molecular formula C26H29N9O4S2 and a molecular weight of 595.71 g/mol. Its IUPAC name is benzyl N-[2-[8-[amino-[5-(dimethylsulfamoyl)thiophen-2-yl]amino]-3-(1-methylpyrazol-4-yl)imidazo[1,2-a]pyrazin-6-yl]ethyl]carbamate.
| Compound Name | benzyl N-[2-[8-[amino-[5-(dimethylsulfamoyl)thiophen-2-yl]amino]-3-(1-methylpyrazol-4-yl)imidazo[1,2-a]pyrazin-6-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 71196419 |
| Molecular Formula | C26H29N9O4S2 |
| Molecular Weight | 595.71 g/mol |
| Exact Mass | 595.18 |
| IUPAC Name | benzyl N-[2-[8-[amino-[5-(dimethylsulfamoyl)thiophen-2-yl]amino]-3-(1-methylpyrazol-4-yl)imidazo[1,2-a]pyrazin-6-yl]ethyl]carbamate |
| SMILES | CN(C)S(=O)(=O)c1ccc(N(N)c2nc(CCNC(=O)OCc3ccccc3)cn3c(-c4cnn(C)c4)cnc23)s1 |
| InChI | InChI=1S/C26H29N9O4S2/c1-32(2)41(37,38)23-10-9-22(40-23)35(27)25-24-29-14-21(19-13-30-33(3)15-19)34(24)16-20(31-25)11-12-28-26(36)39-17-18-7-5-4-6-8-18/h4-10,13-16H,11-12,17,27H2,1-3H3,(H,28,36) |
| InChIKey | XAWRQRDDSKLUER-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 152.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.71 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|