C25H34F2N2O2 — CID 71197337
[(3aR,4R,6aS)-4-[4-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(oxan-4-yl)methanone (PubChem CID 71197337) has the molecular formula C25H34F2N2O2 and a molecular weight of 432.56 g/mol. Its IUPAC name is [(3aR,4R,6aS)-4-[4-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(oxan-4-yl)methanone.
| Compound Name | [(3aR,4R,6aS)-4-[4-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(oxan-4-yl)methanone |
|---|---|
| PubChem CID | 71197337 |
| Molecular Formula | C25H34F2N2O2 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.26 |
| IUPAC Name | [(3aR,4R,6aS)-4-[4-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(oxan-4-yl)methanone |
| SMILES | O=C(C1CCOCC1)N1C[C@H]2CC[C@@H](c3ccc(CCN4CCC(F)(F)C4)cc3)[C@H]2C1 |
| InChI | InChI=1S/C25H34F2N2O2/c26-25(27)10-12-28(17-25)11-7-18-1-3-19(4-2-18)22-6-5-21-15-29(16-23(21)22)24(30)20-8-13-31-14-9-20/h1-4,20-23H,5-17H2/t21-,22+,23+/m1/s1 |
| InChIKey | RKLOTAMQMIYQGJ-VJBWXMMDSA-N |
| XLogP | 3.95 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |