C9H14O6 — CID 71197714
(5R,7S,8S)-7,8-dihydroxy-2,2-dimethyl-1,3,10-trioxaspiro[4.5]decan-6-one (PubChem CID 71197714) has the molecular formula C9H14O6 and a molecular weight of 218.20 g/mol. Its IUPAC name is (5R,7S,8S)-7,8-dihydroxy-2,2-dimethyl-1,3,10-trioxaspiro[4.5]decan-6-one.
| Compound Name | (5R,7S,8S)-7,8-dihydroxy-2,2-dimethyl-1,3,10-trioxaspiro[4.5]decan-6-one |
|---|---|
| PubChem CID | 71197714 |
| Molecular Formula | C9H14O6 |
| Molecular Weight | 218.20 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | (5R,7S,8S)-7,8-dihydroxy-2,2-dimethyl-1,3,10-trioxaspiro[4.5]decan-6-one |
| SMILES | CC1(C)OC[C@@]2(OC[C@H](O)[C@H](O)C2=O)O1 |
| InChI | InChI=1S/C9H14O6/c1-8(2)14-4-9(15-8)7(12)6(11)5(10)3-13-9/h5-6,10-11H,3-4H2,1-2H3/t5-,6-,9+/m0/s1 |
| InChIKey | RDTDFLCQMKPKBO-ATVXKPNKSA-N |
| XLogP | -1.21 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.20 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |