C25H32O5 — CID 71197819
4-[2-(4,4-dimethyl-2,3-dihydrochromen-7-yl)heptanoyloxy]cyclohexa-1,3-diene-1-carboxylic acid (PubChem CID 71197819) has the molecular formula C25H32O5 and a molecular weight of 412.53 g/mol. Its IUPAC name is 4-[2-(4,4-dimethyl-2,3-dihydrochromen-7-yl)heptanoyloxy]cyclohexa-1,3-diene-1-carboxylic acid.
| Compound Name | 4-[2-(4,4-dimethyl-2,3-dihydrochromen-7-yl)heptanoyloxy]cyclohexa-1,3-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 71197819 |
| Molecular Formula | C25H32O5 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | 4-[2-(4,4-dimethyl-2,3-dihydrochromen-7-yl)heptanoyloxy]cyclohexa-1,3-diene-1-carboxylic acid |
| SMILES | CCCCCC(C(=O)OC1=CC=C(C(=O)O)CC1)c1ccc2c(c1)OCCC2(C)C |
| InChI | InChI=1S/C25H32O5/c1-4-5-6-7-20(24(28)30-19-11-8-17(9-12-19)23(26)27)18-10-13-21-22(16-18)29-15-14-25(21,2)3/h8,10-11,13,16,20H,4-7,9,12,14-15H2,1-3H3,(H,26,27) |
| InChIKey | HNSBPDFTJKNBFU-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|