About 1-(4-iodocyclohexa-1,3-dien-1-yl)oxybutan-2-amine
1-(4-iodocyclohexa-1,3-dien-1-yl)oxybutan-2-amine (PubChem CID 71198610) has the molecular formula C10H16INO
and a molecular weight of 293.15 g/mol. Its IUPAC name is 1-(4-iodocyclohexa-1,3-dien-1-yl)oxybutan-2-amine.
Molecular Properties
| Compound Name | 1-(4-iodocyclohexa-1,3-dien-1-yl)oxybutan-2-amine |
| PubChem CID | 71198610 |
| Molecular Formula | C10H16INO |
| Molecular Weight | 293.15 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | 1-(4-iodocyclohexa-1,3-dien-1-yl)oxybutan-2-amine |
| SMILES | CCC(N)COC1=CC=C(I)CC1 |
| InChI | InChI=1S/C10H16INO/c1-2-9(12)7-13-10-5-3-8(11)4-6-10/h3,5,9H,2,4,6-7,12H2,1H3 |
| InChIKey | RSZYYOTVMKGUIK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.15 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-iodocyclohexa-1,3-dien-1-yl)oxybutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-iodocyclohexa-1,3-dien-1-yl)oxybutan-2-amine?
The IUPAC name of 1-(4-iodocyclohexa-1,3-dien-1-yl)oxybutan-2-amine (CID 71198610) is 1-(4-iodocyclohexa-1,3-dien-1-yl)oxybutan-2-amine.
What is the SMILES notation for 1-(4-iodocyclohexa-1,3-dien-1-yl)oxybutan-2-amine?
The canonical SMILES for 1-(4-iodocyclohexa-1,3-dien-1-yl)oxybutan-2-amine is CCC(N)COC1=CC=C(I)CC1.
What is the InChIKey of 1-(4-iodocyclohexa-1,3-dien-1-yl)oxybutan-2-amine?
The InChIKey is RSZYYOTVMKGUIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16INO/c1-2-9(12)7-13-10-5-3-8(11)4-6-10/h3,5,9H,2,4,6-7,12H2,1H3.
What are the key properties of 1-(4-iodocyclohexa-1,3-dien-1-yl)oxybutan-2-amine?
1-(4-iodocyclohexa-1,3-dien-1-yl)oxybutan-2-amine has a molecular weight of 293.15 g/mol, XLogP of 2.74, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-iodocyclohexa-1,3-dien-1-yl)oxybutan-2-amine is sourced from PubChem (CID 71198610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).