About 1-(6-chlorobenzo[b][1,4]benzothiazepin-3-yl)propan-1-one
1-(6-chlorobenzo[b][1,4]benzothiazepin-3-yl)propan-1-one (PubChem CID 71198764) has the molecular formula C16H12ClNOS
and a molecular weight of 301.80 g/mol. Its IUPAC name is 1-(6-chlorobenzo[b][1,4]benzothiazepin-3-yl)propan-1-one.
Molecular Properties
| Compound Name | 1-(6-chlorobenzo[b][1,4]benzothiazepin-3-yl)propan-1-one |
| PubChem CID | 71198764 |
| Molecular Formula | C16H12ClNOS |
| Molecular Weight | 301.80 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | 1-(6-chlorobenzo[b][1,4]benzothiazepin-3-yl)propan-1-one |
| SMILES | CCC(=O)c1ccc2c(c1)N=C(Cl)c1ccccc1S2 |
| InChI | InChI=1S/C16H12ClNOS/c1-2-13(19)10-7-8-15-12(9-10)18-16(17)11-5-3-4-6-14(11)20-15/h3-9H,2H2,1H3 |
| InChIKey | HXYCPZWBSNWVSA-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 301.80 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(6-chlorobenzo[b][1,4]benzothiazepin-3-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-chlorobenzo[b][1,4]benzothiazepin-3-yl)propan-1-one?
The IUPAC name of 1-(6-chlorobenzo[b][1,4]benzothiazepin-3-yl)propan-1-one (CID 71198764) is 1-(6-chlorobenzo[b][1,4]benzothiazepin-3-yl)propan-1-one.
What is the SMILES notation for 1-(6-chlorobenzo[b][1,4]benzothiazepin-3-yl)propan-1-one?
The canonical SMILES for 1-(6-chlorobenzo[b][1,4]benzothiazepin-3-yl)propan-1-one is CCC(=O)c1ccc2c(c1)N=C(Cl)c1ccccc1S2.
What is the InChIKey of 1-(6-chlorobenzo[b][1,4]benzothiazepin-3-yl)propan-1-one?
The InChIKey is HXYCPZWBSNWVSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12ClNOS/c1-2-13(19)10-7-8-15-12(9-10)18-16(17)11-5-3-4-6-14(11)20-15/h3-9H,2H2,1H3.
What are the key properties of 1-(6-chlorobenzo[b][1,4]benzothiazepin-3-yl)propan-1-one?
1-(6-chlorobenzo[b][1,4]benzothiazepin-3-yl)propan-1-one has a molecular weight of 301.80 g/mol, XLogP of 5.06, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-chlorobenzo[b][1,4]benzothiazepin-3-yl)propan-1-one is sourced from PubChem (CID 71198764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).