C18H21BO — CID 71198770
5-hydroxy-2,4,6,8,10-pentamethyl-10H-benzo[b][1]benzoborinine (PubChem CID 71198770) has the molecular formula C18H21BO and a molecular weight of 264.18 g/mol. Its IUPAC name is 5-hydroxy-2,4,6,8,10-pentamethyl-10H-benzo[b][1]benzoborinine.
| Compound Name | 5-hydroxy-2,4,6,8,10-pentamethyl-10H-benzo[b][1]benzoborinine |
|---|---|
| PubChem CID | 71198770 |
| Molecular Formula | C18H21BO |
| Molecular Weight | 264.18 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 5-hydroxy-2,4,6,8,10-pentamethyl-10H-benzo[b][1]benzoborinine |
| SMILES | Cc1cc(C)c2c(c1)C(C)c1cc(C)cc(C)c1B2O |
| InChI | InChI=1S/C18H21BO/c1-10-6-12(3)17-15(8-10)14(5)16-9-11(2)7-13(4)18(16)19(17)20/h6-9,14,20H,1-5H3 |
| InChIKey | HEVUYFZVATWHLT-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.18 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|