C19H24BN3O2 — CID 71198973
2-[[4-(4,4,5-trimethyl-5-propan-2-yl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]methyl]benzonitrile (PubChem CID 71198973) has the molecular formula C19H24BN3O2 and a molecular weight of 337.23 g/mol. Its IUPAC name is 2-[[4-(4,4,5-trimethyl-5-propan-2-yl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]methyl]benzonitrile.
| Compound Name | 2-[[4-(4,4,5-trimethyl-5-propan-2-yl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 71198973 |
| Molecular Formula | C19H24BN3O2 |
| Molecular Weight | 337.23 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 2-[[4-(4,4,5-trimethyl-5-propan-2-yl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]methyl]benzonitrile |
| SMILES | CC(C)C1(C)OB(c2cnn(Cc3ccccc3C#N)c2)OC1(C)C |
| InChI | InChI=1S/C19H24BN3O2/c1-14(2)19(5)18(3,4)24-20(25-19)17-11-22-23(13-17)12-16-9-7-6-8-15(16)10-21/h6-9,11,13-14H,12H2,1-5H3 |
| InChIKey | BLVJFBRTQWSAFH-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 60.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.23 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|