About [(3S,4S)-2-oxo-4-phenyl-3-phenylsulfanyl-1-phosphanylazetidin-3-yl] acetate
[(3S,4S)-2-oxo-4-phenyl-3-phenylsulfanyl-1-phosphanylazetidin-3-yl] acetate (PubChem CID 71199291) has the molecular formula C17H16NO3PS
and a molecular weight of 345.36 g/mol. Its IUPAC name is [(3S,4S)-2-oxo-4-phenyl-3-phenylsulfanyl-1-phosphanylazetidin-3-yl] acetate.
Molecular Properties
| Compound Name | [(3S,4S)-2-oxo-4-phenyl-3-phenylsulfanyl-1-phosphanylazetidin-3-yl] acetate |
| PubChem CID | 71199291 |
| Molecular Formula | C17H16NO3PS |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | [(3S,4S)-2-oxo-4-phenyl-3-phenylsulfanyl-1-phosphanylazetidin-3-yl] acetate |
| SMILES | CC(=O)O[C@@]1(Sc2ccccc2)C(=O)N(P)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C17H16NO3PS/c1-12(19)21-17(23-14-10-6-3-7-11-14)15(18(22)16(17)20)13-8-4-2-5-9-13/h2-11,15H,22H2,1H3/t15-,17-/m0/s1 |
| InChIKey | JCGZTXNYDOOOPE-RDJZCZTQSA-N |
| XLogP | 3.41 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(3S,4S)-2-oxo-4-phenyl-3-phenylsulfanyl-1-phosphanylazetidin-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,4S)-2-oxo-4-phenyl-3-phenylsulfanyl-1-phosphanylazetidin-3-yl] acetate?
The IUPAC name of [(3S,4S)-2-oxo-4-phenyl-3-phenylsulfanyl-1-phosphanylazetidin-3-yl] acetate (CID 71199291) is [(3S,4S)-2-oxo-4-phenyl-3-phenylsulfanyl-1-phosphanylazetidin-3-yl] acetate.
What is the SMILES notation for [(3S,4S)-2-oxo-4-phenyl-3-phenylsulfanyl-1-phosphanylazetidin-3-yl] acetate?
The canonical SMILES for [(3S,4S)-2-oxo-4-phenyl-3-phenylsulfanyl-1-phosphanylazetidin-3-yl] acetate is CC(=O)O[C@@]1(Sc2ccccc2)C(=O)N(P)[C@H]1c1ccccc1.
What is the InChIKey of [(3S,4S)-2-oxo-4-phenyl-3-phenylsulfanyl-1-phosphanylazetidin-3-yl] acetate?
The InChIKey is JCGZTXNYDOOOPE-RDJZCZTQSA-N. The full InChI is InChI=1S/C17H16NO3PS/c1-12(19)21-17(23-14-10-6-3-7-11-14)15(18(22)16(17)20)13-8-4-2-5-9-13/h2-11,15H,22H2,1H3/t15-,17-/m0/s1.
What are the key properties of [(3S,4S)-2-oxo-4-phenyl-3-phenylsulfanyl-1-phosphanylazetidin-3-yl] acetate?
[(3S,4S)-2-oxo-4-phenyl-3-phenylsulfanyl-1-phosphanylazetidin-3-yl] acetate has a molecular weight of 345.36 g/mol, XLogP of 3.41, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,4S)-2-oxo-4-phenyl-3-phenylsulfanyl-1-phosphanylazetidin-3-yl] acetate is sourced from PubChem (CID 71199291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).