C8H13N3O6 — CID 71199492
2-[[(2R,3R)-1,3,4-trihydroxybutan-2-yl]oxymethyl]-1,2,4-triazine-3,5-dione (PubChem CID 71199492) has the molecular formula C8H13N3O6 and a molecular weight of 247.21 g/mol. Its IUPAC name is 2-[[(2R,3R)-1,3,4-trihydroxybutan-2-yl]oxymethyl]-1,2,4-triazine-3,5-dione.
| Compound Name | 2-[[(2R,3R)-1,3,4-trihydroxybutan-2-yl]oxymethyl]-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 71199492 |
| Molecular Formula | C8H13N3O6 |
| Molecular Weight | 247.21 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 2-[[(2R,3R)-1,3,4-trihydroxybutan-2-yl]oxymethyl]-1,2,4-triazine-3,5-dione |
| SMILES | O=c1cnn(CO[C@H](CO)[C@H](O)CO)c(=O)[nH]1 |
| InChI | InChI=1S/C8H13N3O6/c12-2-5(14)6(3-13)17-4-11-8(16)10-7(15)1-9-11/h1,5-6,12-14H,2-4H2,(H,10,15,16)/t5-,6-/m1/s1 |
| InChIKey | PAKOWGWIRXWDNT-PHDIDXHHSA-N |
| XLogP | -3.38 |
| TPSA | 137.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.21 |
| LogP ≤ 5 | -3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |