C12H17N4O7P — CID 71199518
[(2R,3R,4R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 71199518) has the molecular formula C12H17N4O7P and a molecular weight of 360.26 g/mol. Its IUPAC name is [(2R,3R,4R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3R,4R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 71199518 |
| Molecular Formula | C12H17N4O7P |
| Molecular Weight | 360.26 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | [(2R,3R,4R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | C[C@]1(O)C(n2ccc3c(N)ncnc32)O[C@H](COP(=O)(O)O)[C@H]1O |
| InChI | InChI=1S/C12H17N4O7P/c1-12(18)8(17)7(4-22-24(19,20)21)23-11(12)16-3-2-6-9(13)14-5-15-10(6)16/h2-3,5,7-8,11,17-18H,4H2,1H3,(H2,13,14,15)(H2,19,20,21)/t7-,8-,11?,12-/m1/s1 |
| InChIKey | UVONPTYDGJLRPH-QUMRWOPLSA-N |
| XLogP | -0.87 |
| TPSA | 173.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.26 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|