C8H14NO6PS — CID 71199540
2-thiophosphoroso-N-[2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide (PubChem CID 71199540) has the molecular formula C8H14NO6PS and a molecular weight of 283.24 g/mol. Its IUPAC name is 2-thiophosphoroso-N-[2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide.
| Compound Name | 2-thiophosphoroso-N-[2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 71199540 |
| Molecular Formula | C8H14NO6PS |
| Molecular Weight | 283.24 g/mol |
| Exact Mass | 283.03 |
| IUPAC Name | 2-thiophosphoroso-N-[2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
| SMILES | O=C(CP=S)NC1C(O)OC(CO)C(O)C1O |
| InChI | InChI=1S/C8H14NO6PS/c10-1-3-6(12)7(13)5(8(14)15-3)9-4(11)2-16-17/h3,5-8,10,12-14H,1-2H2,(H,9,11) |
| InChIKey | AWLLRGZDNRPHEA-UHFFFAOYSA-N |
| XLogP | -2.69 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.24 |
| LogP ≤ 5 | -2.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|