About 9-methoxy-2-phenyl-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one
9-methoxy-2-phenyl-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one (PubChem CID 7120016) has the molecular formula C18H14N2O3
and a molecular weight of 306.32 g/mol. Its IUPAC name is 9-methoxy-2-phenyl-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 9-methoxy-2-phenyl-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one |
| PubChem CID | 7120016 |
| Molecular Formula | C18H14N2O3 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 9-methoxy-2-phenyl-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one |
| SMILES | COc1cccc2c1Oc1nc(-c3ccccc3)[nH]c(=O)c1C2 |
| InChI | InChI=1S/C18H14N2O3/c1-22-14-9-5-8-12-10-13-17(21)19-16(11-6-3-2-4-7-11)20-18(13)23-15(12)14/h2-9H,10H2,1H3,(H,19,20,21) |
| InChIKey | PILKIABBXURYPX-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-methoxy-2-phenyl-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methoxy-2-phenyl-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one?
The IUPAC name of 9-methoxy-2-phenyl-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one (CID 7120016) is 9-methoxy-2-phenyl-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one.
What is the SMILES notation for 9-methoxy-2-phenyl-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one?
The canonical SMILES for 9-methoxy-2-phenyl-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one is COc1cccc2c1Oc1nc(-c3ccccc3)[nH]c(=O)c1C2.
What is the InChIKey of 9-methoxy-2-phenyl-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one?
The InChIKey is PILKIABBXURYPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N2O3/c1-22-14-9-5-8-12-10-13-17(21)19-16(11-6-3-2-4-7-11)20-18(13)23-15(12)14/h2-9H,10H2,1H3,(H,19,20,21).
What are the key properties of 9-methoxy-2-phenyl-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one?
9-methoxy-2-phenyl-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one has a molecular weight of 306.32 g/mol, XLogP of 3.14, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methoxy-2-phenyl-3,5-dihydrochromeno[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 7120016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).