C24H22ClF3N6O — CID 71200187
1-[2-[5-(3-chloro-4-pyridinyl)-6-[4-(trifluoromethyl)phenyl]-1,2,4-triazin-3-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]propan-1-one (PubChem CID 71200187) has the molecular formula C24H22ClF3N6O and a molecular weight of 502.93 g/mol. Its IUPAC name is 1-[2-[5-(3-chloro-4-pyridinyl)-6-[4-(trifluoromethyl)phenyl]-1,2,4-triazin-3-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]propan-1-one.
| Compound Name | 1-[2-[5-(3-chloro-4-pyridinyl)-6-[4-(trifluoromethyl)phenyl]-1,2,4-triazin-3-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]propan-1-one |
|---|---|
| PubChem CID | 71200187 |
| Molecular Formula | C24H22ClF3N6O |
| Molecular Weight | 502.93 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | 1-[2-[5-(3-chloro-4-pyridinyl)-6-[4-(trifluoromethyl)phenyl]-1,2,4-triazin-3-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]propan-1-one |
| SMILES | CCC(=O)N1CC2CN(c3nnc(-c4ccc(C(F)(F)F)cc4)c(-c4ccncc4Cl)n3)CC2C1 |
| InChI | InChI=1S/C24H22ClF3N6O/c1-2-20(35)33-10-15-12-34(13-16(15)11-33)23-30-22(18-7-8-29-9-19(18)25)21(31-32-23)14-3-5-17(6-4-14)24(26,27)28/h3-9,15-16H,2,10-13H2,1H3 |
| InChIKey | DQRJIQDDXQQAQT-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 75.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.93 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |