C24H40O3 — CID 71200202
(2E,4R,8R,9Z)-4-(methoxymethyl)-3,8-dimethyl-6-[(6S)-6-methyl-5-oxononan-2-yl]cyclodeca-2,9-dien-1-one (PubChem CID 71200202) has the molecular formula C24H40O3 and a molecular weight of 376.58 g/mol. Its IUPAC name is (2E,4R,8R,9Z)-4-(methoxymethyl)-3,8-dimethyl-6-[(6S)-6-methyl-5-oxononan-2-yl]cyclodeca-2,9-dien-1-one.
| Compound Name | (2E,4R,8R,9Z)-4-(methoxymethyl)-3,8-dimethyl-6-[(6S)-6-methyl-5-oxononan-2-yl]cyclodeca-2,9-dien-1-one |
|---|---|
| PubChem CID | 71200202 |
| Molecular Formula | C24H40O3 |
| Molecular Weight | 376.58 g/mol |
| Exact Mass | 376.30 |
| IUPAC Name | (2E,4R,8R,9Z)-4-(methoxymethyl)-3,8-dimethyl-6-[(6S)-6-methyl-5-oxononan-2-yl]cyclodeca-2,9-dien-1-one |
| SMILES | CCC[C@H](C)C(=O)CCC(C)C1C[C@@H](COC)/C(C)=C/C(=O)/C=C\[C@H](C)C1 |
| InChI | InChI=1S/C24H40O3/c1-7-8-19(4)24(26)12-10-18(3)21-13-17(2)9-11-23(25)14-20(5)22(15-21)16-27-6/h9,11,14,17-19,21-22H,7-8,10,12-13,15-16H2,1-6H3/b11-9-,20-14+/t17-,18?,19-,21?,22-/m0/s1 |
| InChIKey | WSUCIISHVAFECM-PFNVXPGLSA-N |
| XLogP | 5.79 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.58 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |