About N-[1-[5,6-bis(4-fluorophenyl)pyrazin-2-yl]piperidin-4-yl]-3-methoxypropanamide
N-[1-[5,6-bis(4-fluorophenyl)pyrazin-2-yl]piperidin-4-yl]-3-methoxypropanamide (PubChem CID 71200295) has the molecular formula C25H26F2N4O2
and a molecular weight of 452.51 g/mol. Its IUPAC name is N-[1-[5,6-bis(4-fluorophenyl)pyrazin-2-yl]piperidin-4-yl]-3-methoxypropanamide.
Molecular Properties
| Compound Name | N-[1-[5,6-bis(4-fluorophenyl)pyrazin-2-yl]piperidin-4-yl]-3-methoxypropanamide |
| PubChem CID | 71200295 |
| Molecular Formula | C25H26F2N4O2 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | N-[1-[5,6-bis(4-fluorophenyl)pyrazin-2-yl]piperidin-4-yl]-3-methoxypropanamide |
| SMILES | COCCC(=O)NC1CCN(c2cnc(-c3ccc(F)cc3)c(-c3ccc(F)cc3)n2)CC1 |
| InChI | InChI=1S/C25H26F2N4O2/c1-33-15-12-23(32)29-21-10-13-31(14-11-21)22-16-28-24(17-2-6-19(26)7-3-17)25(30-22)18-4-8-20(27)9-5-18/h2-9,16,21H,10-15H2,1H3,(H,29,32) |
| InChIKey | KSORZMXEERGUGM-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[1-[5,6-bis(4-fluorophenyl)pyrazin-2-yl]piperidin-4-yl]-3-methoxypropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[5,6-bis(4-fluorophenyl)pyrazin-2-yl]piperidin-4-yl]-3-methoxypropanamide?
The IUPAC name of N-[1-[5,6-bis(4-fluorophenyl)pyrazin-2-yl]piperidin-4-yl]-3-methoxypropanamide (CID 71200295) is N-[1-[5,6-bis(4-fluorophenyl)pyrazin-2-yl]piperidin-4-yl]-3-methoxypropanamide.
What is the SMILES notation for N-[1-[5,6-bis(4-fluorophenyl)pyrazin-2-yl]piperidin-4-yl]-3-methoxypropanamide?
The canonical SMILES for N-[1-[5,6-bis(4-fluorophenyl)pyrazin-2-yl]piperidin-4-yl]-3-methoxypropanamide is COCCC(=O)NC1CCN(c2cnc(-c3ccc(F)cc3)c(-c3ccc(F)cc3)n2)CC1.
What is the InChIKey of N-[1-[5,6-bis(4-fluorophenyl)pyrazin-2-yl]piperidin-4-yl]-3-methoxypropanamide?
The InChIKey is KSORZMXEERGUGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H26F2N4O2/c1-33-15-12-23(32)29-21-10-13-31(14-11-21)22-16-28-24(17-2-6-19(26)7-3-17)25(30-22)18-4-8-20(27)9-5-18/h2-9,16,21H,10-15H2,1H3,(H,29,32).
What are the key properties of N-[1-[5,6-bis(4-fluorophenyl)pyrazin-2-yl]piperidin-4-yl]-3-methoxypropanamide?
N-[1-[5,6-bis(4-fluorophenyl)pyrazin-2-yl]piperidin-4-yl]-3-methoxypropanamide has a molecular weight of 452.51 g/mol, XLogP of 4.21, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[5,6-bis(4-fluorophenyl)pyrazin-2-yl]piperidin-4-yl]-3-methoxypropanamide is sourced from PubChem (CID 71200295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).