About 6-(3,4-diaminothiolan-2-yl)hexan-2-one
6-(3,4-diaminothiolan-2-yl)hexan-2-one (PubChem CID 71200818) has the molecular formula C10H20N2OS
and a molecular weight of 216.35 g/mol. Its IUPAC name is 6-(3,4-diaminothiolan-2-yl)hexan-2-one.
Molecular Properties
| Compound Name | 6-(3,4-diaminothiolan-2-yl)hexan-2-one |
| PubChem CID | 71200818 |
| Molecular Formula | C10H20N2OS |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 6-(3,4-diaminothiolan-2-yl)hexan-2-one |
| SMILES | CC(=O)CCCCC1SCC(N)C1N |
| InChI | InChI=1S/C10H20N2OS/c1-7(13)4-2-3-5-9-10(12)8(11)6-14-9/h8-10H,2-6,11-12H2,1H3 |
| InChIKey | FQCZGPJAHXXXTI-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(3,4-diaminothiolan-2-yl)hexan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3,4-diaminothiolan-2-yl)hexan-2-one?
The IUPAC name of 6-(3,4-diaminothiolan-2-yl)hexan-2-one (CID 71200818) is 6-(3,4-diaminothiolan-2-yl)hexan-2-one.
What is the SMILES notation for 6-(3,4-diaminothiolan-2-yl)hexan-2-one?
The canonical SMILES for 6-(3,4-diaminothiolan-2-yl)hexan-2-one is CC(=O)CCCCC1SCC(N)C1N.
What is the InChIKey of 6-(3,4-diaminothiolan-2-yl)hexan-2-one?
The InChIKey is FQCZGPJAHXXXTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2OS/c1-7(13)4-2-3-5-9-10(12)8(11)6-14-9/h8-10H,2-6,11-12H2,1H3.
What are the key properties of 6-(3,4-diaminothiolan-2-yl)hexan-2-one?
6-(3,4-diaminothiolan-2-yl)hexan-2-one has a molecular weight of 216.35 g/mol, XLogP of 0.91, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,4-diaminothiolan-2-yl)hexan-2-one is sourced from PubChem (CID 71200818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).