About ethyl 2-oxo-5-(trifluoromethoxy)spiro[1H-indole-3,2'-cyclopropane]-1'-carboxylate
ethyl 2-oxo-5-(trifluoromethoxy)spiro[1H-indole-3,2'-cyclopropane]-1'-carboxylate (PubChem CID 71200919) has the molecular formula C14H12F3NO4
and a molecular weight of 315.25 g/mol. Its IUPAC name is ethyl 2-oxo-5-(trifluoromethoxy)spiro[1H-indole-3,2'-cyclopropane]-1'-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-oxo-5-(trifluoromethoxy)spiro[1H-indole-3,2'-cyclopropane]-1'-carboxylate |
| PubChem CID | 71200919 |
| Molecular Formula | C14H12F3NO4 |
| Molecular Weight | 315.25 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | ethyl 2-oxo-5-(trifluoromethoxy)spiro[1H-indole-3,2'-cyclopropane]-1'-carboxylate |
| SMILES | CCOC(=O)C1CC12C(=O)Nc1ccc(OC(F)(F)F)cc12 |
| InChI | InChI=1S/C14H12F3NO4/c1-2-21-11(19)9-6-13(9)8-5-7(22-14(15,16)17)3-4-10(8)18-12(13)20/h3-5,9H,2,6H2,1H3,(H,18,20) |
| InChIKey | RVWBZHPWKSOCOL-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.25 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-oxo-5-(trifluoromethoxy)spiro[1H-indole-3,2'-cyclopropane]-1'-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-oxo-5-(trifluoromethoxy)spiro[1H-indole-3,2'-cyclopropane]-1'-carboxylate?
The IUPAC name of ethyl 2-oxo-5-(trifluoromethoxy)spiro[1H-indole-3,2'-cyclopropane]-1'-carboxylate (CID 71200919) is ethyl 2-oxo-5-(trifluoromethoxy)spiro[1H-indole-3,2'-cyclopropane]-1'-carboxylate.
What is the SMILES notation for ethyl 2-oxo-5-(trifluoromethoxy)spiro[1H-indole-3,2'-cyclopropane]-1'-carboxylate?
The canonical SMILES for ethyl 2-oxo-5-(trifluoromethoxy)spiro[1H-indole-3,2'-cyclopropane]-1'-carboxylate is CCOC(=O)C1CC12C(=O)Nc1ccc(OC(F)(F)F)cc12.
What is the InChIKey of ethyl 2-oxo-5-(trifluoromethoxy)spiro[1H-indole-3,2'-cyclopropane]-1'-carboxylate?
The InChIKey is RVWBZHPWKSOCOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12F3NO4/c1-2-21-11(19)9-6-13(9)8-5-7(22-14(15,16)17)3-4-10(8)18-12(13)20/h3-5,9H,2,6H2,1H3,(H,18,20).
What are the key properties of ethyl 2-oxo-5-(trifluoromethoxy)spiro[1H-indole-3,2'-cyclopropane]-1'-carboxylate?
ethyl 2-oxo-5-(trifluoromethoxy)spiro[1H-indole-3,2'-cyclopropane]-1'-carboxylate has a molecular weight of 315.25 g/mol, XLogP of 2.36, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-oxo-5-(trifluoromethoxy)spiro[1H-indole-3,2'-cyclopropane]-1'-carboxylate is sourced from PubChem (CID 71200919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).