C26H23F3N6O3S — CID 71201239
2-N-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-7-(4-methylphenyl)sulfonyl-4-N-(2,2,2-trifluoroethyl)pyrrolo[2,3-d]pyrimidine-2,4-diamine (PubChem CID 71201239) has the molecular formula C26H23F3N6O3S and a molecular weight of 556.57 g/mol. Its IUPAC name is 2-N-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-7-(4-methylphenyl)sulfonyl-4-N-(2,2,2-trifluoroethyl)pyrrolo[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 2-N-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-7-(4-methylphenyl)sulfonyl-4-N-(2,2,2-trifluoroethyl)pyrrolo[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 71201239 |
| Molecular Formula | C26H23F3N6O3S |
| Molecular Weight | 556.57 g/mol |
| Exact Mass | 556.15 |
| IUPAC Name | 2-N-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-7-(4-methylphenyl)sulfonyl-4-N-(2,2,2-trifluoroethyl)pyrrolo[2,3-d]pyrimidine-2,4-diamine |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3c(NCC(F)(F)F)nc(Nc4ccc(-c5c(C)noc5C)cc4)nc32)cc1 |
| InChI | InChI=1S/C26H23F3N6O3S/c1-15-4-10-20(11-5-15)39(36,37)35-13-12-21-23(30-14-26(27,28)29)32-25(33-24(21)35)31-19-8-6-18(7-9-19)22-16(2)34-38-17(22)3/h4-13H,14H2,1-3H3,(H2,30,31,32,33) |
| InChIKey | YWKKFKYAXMXQRS-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 114.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.57 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |