About N-cyclohexyl-2,5-dimethylthiophene-3-sulfonamide
N-cyclohexyl-2,5-dimethylthiophene-3-sulfonamide (PubChem CID 712013) has the molecular formula C12H19NO2S2
and a molecular weight of 273.42 g/mol. Its IUPAC name is N-cyclohexyl-2,5-dimethylthiophene-3-sulfonamide.
Molecular Properties
| Compound Name | N-cyclohexyl-2,5-dimethylthiophene-3-sulfonamide |
| PubChem CID | 712013 |
| Molecular Formula | C12H19NO2S2 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | N-cyclohexyl-2,5-dimethylthiophene-3-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NC2CCCCC2)c(C)s1 |
| InChI | InChI=1S/C12H19NO2S2/c1-9-8-12(10(2)16-9)17(14,15)13-11-6-4-3-5-7-11/h8,11,13H,3-7H2,1-2H3 |
| InChIKey | HYWGSSJEACRWGV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cyclohexyl-2,5-dimethylthiophene-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-2,5-dimethylthiophene-3-sulfonamide?
The IUPAC name of N-cyclohexyl-2,5-dimethylthiophene-3-sulfonamide (CID 712013) is N-cyclohexyl-2,5-dimethylthiophene-3-sulfonamide.
What is the SMILES notation for N-cyclohexyl-2,5-dimethylthiophene-3-sulfonamide?
The canonical SMILES for N-cyclohexyl-2,5-dimethylthiophene-3-sulfonamide is Cc1cc(S(=O)(=O)NC2CCCCC2)c(C)s1.
What is the InChIKey of N-cyclohexyl-2,5-dimethylthiophene-3-sulfonamide?
The InChIKey is HYWGSSJEACRWGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO2S2/c1-9-8-12(10(2)16-9)17(14,15)13-11-6-4-3-5-7-11/h8,11,13H,3-7H2,1-2H3.
What are the key properties of N-cyclohexyl-2,5-dimethylthiophene-3-sulfonamide?
N-cyclohexyl-2,5-dimethylthiophene-3-sulfonamide has a molecular weight of 273.42 g/mol, XLogP of 2.98, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-2,5-dimethylthiophene-3-sulfonamide is sourced from PubChem (CID 712013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).