C23H20N4 — CID 7120150
7-methyl-3-[(1R)-1-phenylethyl]-1,3,10-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-2(6),7,9,11,13,15-hexaene-8-carbonitrile (PubChem CID 7120150) has the molecular formula C23H20N4 and a molecular weight of 352.44 g/mol. Its IUPAC name is 7-methyl-3-[(1R)-1-phenylethyl]-1,3,10-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-2(6),7,9,11,13,15-hexaene-8-carbonitrile.
| Compound Name | 7-methyl-3-[(1R)-1-phenylethyl]-1,3,10-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-2(6),7,9,11,13,15-hexaene-8-carbonitrile |
|---|---|
| PubChem CID | 7120150 |
| Molecular Formula | C23H20N4 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 7-methyl-3-[(1R)-1-phenylethyl]-1,3,10-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-2(6),7,9,11,13,15-hexaene-8-carbonitrile |
| SMILES | Cc1c2c(n3c(nc4ccccc43)c1C#N)N([C@H](C)c1ccccc1)CC2 |
| InChI | InChI=1S/C23H20N4/c1-15-18-12-13-26(16(2)17-8-4-3-5-9-17)23(18)27-21-11-7-6-10-20(21)25-22(27)19(15)14-24/h3-11,16H,12-13H2,1-2H3/t16-/m1/s1 |
| InChIKey | AEOYRDWIWWOEIY-MRXNPFEDSA-N |
| XLogP | 4.79 |
| TPSA | 44.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |