C15H21BO5 — CID 71201619
[4-(cyclohexa-1,5-dien-1-ylmethoxy)-3,6-dimethoxycyclohexa-1,5-dien-1-yl]boronic acid (PubChem CID 71201619) has the molecular formula C15H21BO5 and a molecular weight of 292.14 g/mol. Its IUPAC name is [4-(cyclohexa-1,5-dien-1-ylmethoxy)-3,6-dimethoxycyclohexa-1,5-dien-1-yl]boronic acid.
| Compound Name | [4-(cyclohexa-1,5-dien-1-ylmethoxy)-3,6-dimethoxycyclohexa-1,5-dien-1-yl]boronic acid |
|---|---|
| PubChem CID | 71201619 |
| Molecular Formula | C15H21BO5 |
| Molecular Weight | 292.14 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | [4-(cyclohexa-1,5-dien-1-ylmethoxy)-3,6-dimethoxycyclohexa-1,5-dien-1-yl]boronic acid |
| SMILES | COC1=CC(OCC2=CCCC=C2)C(OC)C=C1B(O)O |
| InChI | InChI=1S/C15H21BO5/c1-19-13-9-15(14(20-2)8-12(13)16(17)18)21-10-11-6-4-3-5-7-11/h4,6-9,14-15,17-18H,3,5,10H2,1-2H3 |
| InChIKey | PJNRGRVSVBKGMH-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.14 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|