About (1R)-2-butylsulfanyl-3,3-dimethyl-1-(4-methylphenyl)butan-1-ol
(1R)-2-butylsulfanyl-3,3-dimethyl-1-(4-methylphenyl)butan-1-ol (PubChem CID 71201684) has the molecular formula C17H28OS
and a molecular weight of 280.48 g/mol. Its IUPAC name is (1R)-2-butylsulfanyl-3,3-dimethyl-1-(4-methylphenyl)butan-1-ol.
Molecular Properties
| Compound Name | (1R)-2-butylsulfanyl-3,3-dimethyl-1-(4-methylphenyl)butan-1-ol |
| PubChem CID | 71201684 |
| Molecular Formula | C17H28OS |
| Molecular Weight | 280.48 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | (1R)-2-butylsulfanyl-3,3-dimethyl-1-(4-methylphenyl)butan-1-ol |
| SMILES | CCCCSC([C@H](O)c1ccc(C)cc1)C(C)(C)C |
| InChI | InChI=1S/C17H28OS/c1-6-7-12-19-16(17(3,4)5)15(18)14-10-8-13(2)9-11-14/h8-11,15-16,18H,6-7,12H2,1-5H3/t15-,16?/m1/s1 |
| InChIKey | YHGGFKAIEZHTSL-AAFJCEBUSA-N |
| XLogP | 4.98 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.48 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (1R)-2-butylsulfanyl-3,3-dimethyl-1-(4-methylphenyl)butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-2-butylsulfanyl-3,3-dimethyl-1-(4-methylphenyl)butan-1-ol?
The IUPAC name of (1R)-2-butylsulfanyl-3,3-dimethyl-1-(4-methylphenyl)butan-1-ol (CID 71201684) is (1R)-2-butylsulfanyl-3,3-dimethyl-1-(4-methylphenyl)butan-1-ol.
What is the SMILES notation for (1R)-2-butylsulfanyl-3,3-dimethyl-1-(4-methylphenyl)butan-1-ol?
The canonical SMILES for (1R)-2-butylsulfanyl-3,3-dimethyl-1-(4-methylphenyl)butan-1-ol is CCCCSC([C@H](O)c1ccc(C)cc1)C(C)(C)C.
What is the InChIKey of (1R)-2-butylsulfanyl-3,3-dimethyl-1-(4-methylphenyl)butan-1-ol?
The InChIKey is YHGGFKAIEZHTSL-AAFJCEBUSA-N. The full InChI is InChI=1S/C17H28OS/c1-6-7-12-19-16(17(3,4)5)15(18)14-10-8-13(2)9-11-14/h8-11,15-16,18H,6-7,12H2,1-5H3/t15-,16?/m1/s1.
What are the key properties of (1R)-2-butylsulfanyl-3,3-dimethyl-1-(4-methylphenyl)butan-1-ol?
(1R)-2-butylsulfanyl-3,3-dimethyl-1-(4-methylphenyl)butan-1-ol has a molecular weight of 280.48 g/mol, XLogP of 4.98, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-2-butylsulfanyl-3,3-dimethyl-1-(4-methylphenyl)butan-1-ol is sourced from PubChem (CID 71201684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).