C44H47N3O6 — CID 71201807
N-[4-[[4-(butylcarbamoyl)-2-[(4-methylphenyl)methoxy]phenyl]carbamoyl]-2-propan-2-yloxyphenyl]-4-methyl-3-phenylmethoxybenzamide (PubChem CID 71201807) has the molecular formula C44H47N3O6 and a molecular weight of 713.88 g/mol. Its IUPAC name is N-[4-[[4-(butylcarbamoyl)-2-[(4-methylphenyl)methoxy]phenyl]carbamoyl]-2-propan-2-yloxyphenyl]-4-methyl-3-phenylmethoxybenzamide.
| Compound Name | N-[4-[[4-(butylcarbamoyl)-2-[(4-methylphenyl)methoxy]phenyl]carbamoyl]-2-propan-2-yloxyphenyl]-4-methyl-3-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 71201807 |
| Molecular Formula | C44H47N3O6 |
| Molecular Weight | 713.88 g/mol |
| Exact Mass | 713.35 |
| IUPAC Name | N-[4-[[4-(butylcarbamoyl)-2-[(4-methylphenyl)methoxy]phenyl]carbamoyl]-2-propan-2-yloxyphenyl]-4-methyl-3-phenylmethoxybenzamide |
| SMILES | CCCCNC(=O)c1ccc(NC(=O)c2ccc(NC(=O)c3ccc(C)c(OCc4ccccc4)c3)c(OC(C)C)c2)c(OCc2ccc(C)cc2)c1 |
| InChI | InChI=1S/C44H47N3O6/c1-6-7-23-45-42(48)34-19-21-37(40(25-34)52-28-33-16-13-30(4)14-17-33)46-44(50)36-20-22-38(41(26-36)53-29(2)3)47-43(49)35-18-15-31(5)39(24-35)51-27-32-11-9-8-10-12-32/h8-22,24-26,29H,6-7,23,27-28H2,1-5H3,(H,45,48)(H,46,50)(H,47,49) |
| InChIKey | FLODUQRTUXJCIC-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.88 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|