C20H15ClF3N7O2 — CID 71201854
methyl N-[4,6-diamino-2-[5-chloro-3-[(2,3,6-trifluorophenyl)methyl]indazol-1-yl]pyrimidin-5-yl]carbamate (PubChem CID 71201854) has the molecular formula C20H15ClF3N7O2 and a molecular weight of 477.83 g/mol. Its IUPAC name is methyl N-[4,6-diamino-2-[5-chloro-3-[(2,3,6-trifluorophenyl)methyl]indazol-1-yl]pyrimidin-5-yl]carbamate.
| Compound Name | methyl N-[4,6-diamino-2-[5-chloro-3-[(2,3,6-trifluorophenyl)methyl]indazol-1-yl]pyrimidin-5-yl]carbamate |
|---|---|
| PubChem CID | 71201854 |
| Molecular Formula | C20H15ClF3N7O2 |
| Molecular Weight | 477.83 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | methyl N-[4,6-diamino-2-[5-chloro-3-[(2,3,6-trifluorophenyl)methyl]indazol-1-yl]pyrimidin-5-yl]carbamate |
| SMILES | COC(=O)Nc1c(N)nc(-n2nc(Cc3c(F)ccc(F)c3F)c3cc(Cl)ccc32)nc1N |
| InChI | InChI=1S/C20H15ClF3N7O2/c1-33-20(32)27-16-17(25)28-19(29-18(16)26)31-14-5-2-8(21)6-10(14)13(30-31)7-9-11(22)3-4-12(23)15(9)24/h2-6H,7H2,1H3,(H,27,32)(H4,25,26,28,29) |
| InChIKey | VHRRBXAJORNNNP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 133.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.83 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|