C20H16F3N7O2 — CID 71201856
methyl N-[4,6-diamino-2-[3-[(2,3,6-trifluorophenyl)methyl]indazol-1-yl]pyrimidin-5-yl]carbamate (PubChem CID 71201856) has the molecular formula C20H16F3N7O2 and a molecular weight of 443.39 g/mol. Its IUPAC name is methyl N-[4,6-diamino-2-[3-[(2,3,6-trifluorophenyl)methyl]indazol-1-yl]pyrimidin-5-yl]carbamate.
| Compound Name | methyl N-[4,6-diamino-2-[3-[(2,3,6-trifluorophenyl)methyl]indazol-1-yl]pyrimidin-5-yl]carbamate |
|---|---|
| PubChem CID | 71201856 |
| Molecular Formula | C20H16F3N7O2 |
| Molecular Weight | 443.39 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | methyl N-[4,6-diamino-2-[3-[(2,3,6-trifluorophenyl)methyl]indazol-1-yl]pyrimidin-5-yl]carbamate |
| SMILES | COC(=O)Nc1c(N)nc(-n2nc(Cc3c(F)ccc(F)c3F)c3ccccc32)nc1N |
| InChI | InChI=1S/C20H16F3N7O2/c1-32-20(31)26-16-17(24)27-19(28-18(16)25)30-14-5-3-2-4-9(14)13(29-30)8-10-11(21)6-7-12(22)15(10)23/h2-7H,8H2,1H3,(H,26,31)(H4,24,25,27,28) |
| InChIKey | AAEDBQPJKMDUCR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 133.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|