C12H23N3O2 — CID 71202251
(3aS,6aR)-5-(hydroxymethylamino)-N,N,5-trimethyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxamide (PubChem CID 71202251) has the molecular formula C12H23N3O2 and a molecular weight of 241.33 g/mol. Its IUPAC name is (3aS,6aR)-5-(hydroxymethylamino)-N,N,5-trimethyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxamide.
| Compound Name | (3aS,6aR)-5-(hydroxymethylamino)-N,N,5-trimethyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 71202251 |
| Molecular Formula | C12H23N3O2 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | (3aS,6aR)-5-(hydroxymethylamino)-N,N,5-trimethyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxamide |
| SMILES | CN(C)C(=O)N1C[C@@H]2CC(C)(NCO)C[C@@H]2C1 |
| InChI | InChI=1S/C12H23N3O2/c1-12(13-8-16)4-9-6-15(7-10(9)5-12)11(17)14(2)3/h9-10,13,16H,4-8H2,1-3H3/t9-,10+,12? |
| InChIKey | PWYDQBBWHBEVLY-DHHPTOIESA-N |
| XLogP | 0.31 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|