C13H17NO4 — CID 71202354
methyl (7Z,8aR)-7-(hydroxymethylidene)-2-methyl-6-oxo-1,3,4,8-tetrahydroisoquinoline-8a-carboxylate (PubChem CID 71202354) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is methyl (7Z,8aR)-7-(hydroxymethylidene)-2-methyl-6-oxo-1,3,4,8-tetrahydroisoquinoline-8a-carboxylate.
| Compound Name | methyl (7Z,8aR)-7-(hydroxymethylidene)-2-methyl-6-oxo-1,3,4,8-tetrahydroisoquinoline-8a-carboxylate |
|---|---|
| PubChem CID | 71202354 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | methyl (7Z,8aR)-7-(hydroxymethylidene)-2-methyl-6-oxo-1,3,4,8-tetrahydroisoquinoline-8a-carboxylate |
| SMILES | COC(=O)[C@]12C/C(=C/O)C(=O)C=C1CCN(C)C2 |
| InChI | InChI=1S/C13H17NO4/c1-14-4-3-10-5-11(16)9(7-15)6-13(10,8-14)12(17)18-2/h5,7,15H,3-4,6,8H2,1-2H3/b9-7-/t13-/m0/s1 |
| InChIKey | NTJWUBGVPYSUDJ-JWJUJFCLSA-N |
| XLogP | 0.82 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|