About cis-methyl (1R,2S)-2-(2-cyanoethyl)-1-(1-phenylimidazol-4-yl)cyclopropane-1-carboxylate
cis-methyl (1R,2S)-2-(2-cyanoethyl)-1-(1-phenylimidazol-4-yl)cyclopropane-1-carboxylate (PubChem CID 71202519) has the molecular formula C17H17N3O2
and a molecular weight of 295.34 g/mol. Its IUPAC name is cis-methyl (1R,2S)-2-(2-cyanoethyl)-1-(1-phenylimidazol-4-yl)cyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | cis-methyl (1R,2S)-2-(2-cyanoethyl)-1-(1-phenylimidazol-4-yl)cyclopropane-1-carboxylate |
| PubChem CID | 71202519 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | cis-methyl (1R,2S)-2-(2-cyanoethyl)-1-(1-phenylimidazol-4-yl)cyclopropane-1-carboxylate |
| SMILES | COC(=O)[C@]1(c2cn(-c3ccccc3)cn2)C[C@@H]1CCC#N |
| InChI | InChI=1S/C17H17N3O2/c1-22-16(21)17(10-13(17)6-5-9-18)15-11-20(12-19-15)14-7-3-2-4-8-14/h2-4,7-8,11-13H,5-6,10H2,1H3/t13-,17+/m0/s1 |
| InChIKey | YWZXJZMXEKEDNE-SUMWQHHRSA-N |
| XLogP | 2.61 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze cis-methyl (1R,2S)-2-(2-cyanoethyl)-1-(1-phenylimidazol-4-yl)cyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-methyl (1R,2S)-2-(2-cyanoethyl)-1-(1-phenylimidazol-4-yl)cyclopropane-1-carboxylate?
The IUPAC name of cis-methyl (1R,2S)-2-(2-cyanoethyl)-1-(1-phenylimidazol-4-yl)cyclopropane-1-carboxylate (CID 71202519) is cis-methyl (1R,2S)-2-(2-cyanoethyl)-1-(1-phenylimidazol-4-yl)cyclopropane-1-carboxylate.
What is the SMILES notation for cis-methyl (1R,2S)-2-(2-cyanoethyl)-1-(1-phenylimidazol-4-yl)cyclopropane-1-carboxylate?
The canonical SMILES for cis-methyl (1R,2S)-2-(2-cyanoethyl)-1-(1-phenylimidazol-4-yl)cyclopropane-1-carboxylate is COC(=O)[C@]1(c2cn(-c3ccccc3)cn2)C[C@@H]1CCC#N.
What is the InChIKey of cis-methyl (1R,2S)-2-(2-cyanoethyl)-1-(1-phenylimidazol-4-yl)cyclopropane-1-carboxylate?
The InChIKey is YWZXJZMXEKEDNE-SUMWQHHRSA-N. The full InChI is InChI=1S/C17H17N3O2/c1-22-16(21)17(10-13(17)6-5-9-18)15-11-20(12-19-15)14-7-3-2-4-8-14/h2-4,7-8,11-13H,5-6,10H2,1H3/t13-,17+/m0/s1.
What are the key properties of cis-methyl (1R,2S)-2-(2-cyanoethyl)-1-(1-phenylimidazol-4-yl)cyclopropane-1-carboxylate?
cis-methyl (1R,2S)-2-(2-cyanoethyl)-1-(1-phenylimidazol-4-yl)cyclopropane-1-carboxylate has a molecular weight of 295.34 g/mol, XLogP of 2.61, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cis-methyl (1R,2S)-2-(2-cyanoethyl)-1-(1-phenylimidazol-4-yl)cyclopropane-1-carboxylate is sourced from PubChem (CID 71202519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).