About propan-2-yl 5-(1-amino-4,4-dimethylpentyl)thiophene-2-carboxylate
propan-2-yl 5-(1-amino-4,4-dimethylpentyl)thiophene-2-carboxylate (PubChem CID 71202646) has the molecular formula C15H25NO2S
and a molecular weight of 283.44 g/mol. Its IUPAC name is propan-2-yl 5-(1-amino-4,4-dimethylpentyl)thiophene-2-carboxylate.
Molecular Properties
| Compound Name | propan-2-yl 5-(1-amino-4,4-dimethylpentyl)thiophene-2-carboxylate |
| PubChem CID | 71202646 |
| Molecular Formula | C15H25NO2S |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | propan-2-yl 5-(1-amino-4,4-dimethylpentyl)thiophene-2-carboxylate |
| SMILES | CC(C)OC(=O)c1ccc(C(N)CCC(C)(C)C)s1 |
| InChI | InChI=1S/C15H25NO2S/c1-10(2)18-14(17)13-7-6-12(19-13)11(16)8-9-15(3,4)5/h6-7,10-11H,8-9,16H2,1-5H3 |
| InChIKey | VVUYEAYVRQTCNT-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze propan-2-yl 5-(1-amino-4,4-dimethylpentyl)thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 5-(1-amino-4,4-dimethylpentyl)thiophene-2-carboxylate?
The IUPAC name of propan-2-yl 5-(1-amino-4,4-dimethylpentyl)thiophene-2-carboxylate (CID 71202646) is propan-2-yl 5-(1-amino-4,4-dimethylpentyl)thiophene-2-carboxylate.
What is the SMILES notation for propan-2-yl 5-(1-amino-4,4-dimethylpentyl)thiophene-2-carboxylate?
The canonical SMILES for propan-2-yl 5-(1-amino-4,4-dimethylpentyl)thiophene-2-carboxylate is CC(C)OC(=O)c1ccc(C(N)CCC(C)(C)C)s1.
What is the InChIKey of propan-2-yl 5-(1-amino-4,4-dimethylpentyl)thiophene-2-carboxylate?
The InChIKey is VVUYEAYVRQTCNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25NO2S/c1-10(2)18-14(17)13-7-6-12(19-13)11(16)8-9-15(3,4)5/h6-7,10-11H,8-9,16H2,1-5H3.
What are the key properties of propan-2-yl 5-(1-amino-4,4-dimethylpentyl)thiophene-2-carboxylate?
propan-2-yl 5-(1-amino-4,4-dimethylpentyl)thiophene-2-carboxylate has a molecular weight of 283.44 g/mol, XLogP of 4.14, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 5-(1-amino-4,4-dimethylpentyl)thiophene-2-carboxylate is sourced from PubChem (CID 71202646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).