C39H54Cl2N4O4 — CID 71202692
tert-butyl 3-[[4-[(1R)-1-[2-(3,5-dichlorophenyl)-7-(3,3-dimethylbutyl)-3-oxo-1,4,7-triazaspiro[4.4]non-1-en-4-yl]-4,4-dimethylpentyl]benzoyl]amino]propanoate (PubChem CID 71202692) has the molecular formula C39H54Cl2N4O4 and a molecular weight of 713.79 g/mol. Its IUPAC name is tert-butyl 3-[[4-[(1R)-1-[2-(3,5-dichlorophenyl)-7-(3,3-dimethylbutyl)-3-oxo-1,4,7-triazaspiro[4.4]non-1-en-4-yl]-4,4-dimethylpentyl]benzoyl]amino]propanoate.
| Compound Name | tert-butyl 3-[[4-[(1R)-1-[2-(3,5-dichlorophenyl)-7-(3,3-dimethylbutyl)-3-oxo-1,4,7-triazaspiro[4.4]non-1-en-4-yl]-4,4-dimethylpentyl]benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 71202692 |
| Molecular Formula | C39H54Cl2N4O4 |
| Molecular Weight | 713.79 g/mol |
| Exact Mass | 712.35 |
| IUPAC Name | tert-butyl 3-[[4-[(1R)-1-[2-(3,5-dichlorophenyl)-7-(3,3-dimethylbutyl)-3-oxo-1,4,7-triazaspiro[4.4]non-1-en-4-yl]-4,4-dimethylpentyl]benzoyl]amino]propanoate |
| SMILES | CC(C)(C)CC[C@H](c1ccc(C(=O)NCCC(=O)OC(C)(C)C)cc1)N1C(=O)C(c2cc(Cl)cc(Cl)c2)=NC12CCN(CCC(C)(C)C)C2 |
| InChI | InChI=1S/C39H54Cl2N4O4/c1-36(2,3)16-14-31(26-10-12-27(13-11-26)34(47)42-19-15-32(46)49-38(7,8)9)45-35(48)33(28-22-29(40)24-30(41)23-28)43-39(45)18-21-44(25-39)20-17-37(4,5)6/h10-13,22-24,31H,14-21,25H2,1-9H3,(H,42,47)/t31-,39?/m1/s1 |
| InChIKey | JSAULTNBTFLPLT-DDAOKAKDSA-N |
| XLogP | 8.49 |
| TPSA | 91.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.79 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |